CAS 10264-18-3
:N-Phenylpentanamide
Description:
N-Phenylpentanamide, with the CAS number 10264-18-3, is an organic compound characterized by its amide functional group, which consists of a carbonyl group (C=O) directly attached to a nitrogen atom (N). This compound features a pentane chain, indicating that it has five carbon atoms in its longest continuous chain, along with a phenyl group (a benzene ring) attached to the nitrogen atom. The presence of the phenyl group contributes to its aromatic characteristics, influencing its solubility and reactivity. N-Phenylpentanamide is typically a solid at room temperature and may exhibit moderate polarity due to the amide bond, which can engage in hydrogen bonding. This compound is of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential biological activity and utility as a building block in chemical reactions. Its stability and reactivity can be influenced by the surrounding functional groups and the overall molecular structure.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c1-2-3-9-11(13)12-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,12,13)
InChI key:InChIKey=PGMBORLSOHYBFJ-UHFFFAOYSA-N
SMILES:N(C(CCCC)=O)C1=CC=CC=C1
Synonyms:- 2-n-Propylacetanilide
- PMSA 961
- Pentanamide, N-phenyl-
- N-Phenylpentanamide
- Valeranilide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
