
CAS 10264-57-0
:3-Cyclohexylcyclopentanone
Description:
3-Cyclohexylcyclopentanone is an organic compound characterized by its unique bicyclic structure, which consists of a cyclopentanone ring fused with a cyclohexyl group. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. Typically, it appears as a colorless to pale yellow liquid with a distinctive odor. The presence of the cyclohexyl group enhances its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. Its molecular structure allows for various interactions, including hydrogen bonding and van der Waals forces, influencing its boiling and melting points. 3-Cyclohexylcyclopentanone may be utilized in the synthesis of pharmaceuticals, fragrances, and other chemical intermediates due to its versatile reactivity. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C11H18O
InChI:InChI=1S/C11H18O/c12-11-7-6-10(8-11)9-4-2-1-3-5-9/h9-10H,1-8H2
InChI key:InChIKey=ZKWXHMQLBLFZHP-UHFFFAOYSA-N
SMILES:O=C1CC(CC1)C2CCCCC2
Synonyms:- 3-Cyclohexylcyclopentan-1-one
- Cyclopentanone, 3-cyclohexyl-
- 3-Cyclohexylcyclopentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
