CAS 10265-70-0
:1H-Indole-3-butanoic acid monosodium salt
Description:
1H-Indole-3-butanoic acid monosodium salt, with the CAS number 10265-70-0, is a chemical compound that serves as a plant growth regulator. It is a derivative of indole-3-butyric acid (IBA), which is known for its role in promoting root development in plants. The monosodium salt form enhances its solubility in water, making it more accessible for agricultural applications. This compound typically exhibits characteristics such as being a white to off-white crystalline powder, with a moderate molecular weight. It is soluble in water and exhibits stability under normal conditions, although it may be sensitive to extreme pH levels. In terms of biological activity, it functions by influencing plant hormone pathways, particularly auxins, which are crucial for various growth processes. Its application can lead to improved rooting in cuttings and enhanced overall plant growth, making it valuable in horticulture and agriculture. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.
Formula:C12H12NNaO2
InChI:InChI=1/C12H13NO2.Na/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11;/h1-2,5-6,8,13H,3-4,7H2,(H,14,15);/q;+1/p-1
SMILES:c1ccc2c(c1)c(CCCC(=O)O)c[nH]2.[Na]
Synonyms:- Sodium 3-Indolebutyrate
- Sodium 4-(3-indolyl)butanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
