CAS 1026511-90-9
:4-Bromo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine
Description:
4-Bromo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine, with CAS number 1026511-90-9, is a synthetic organic compound that belongs to the class of phenethylamines. This compound features a complex structure characterized by a bromine atom and multiple methoxy groups attached to a benzene ring, which contribute to its unique chemical properties. The presence of the dimethoxy substituents enhances its lipophilicity, potentially affecting its interaction with biological systems. The amine functional group suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. Additionally, the compound's structure indicates potential for pharmacological activity, as many phenethylamines are known for their psychoactive effects. However, specific biological activity and toxicity profiles would require further investigation through empirical studies. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of interest in both synthetic chemistry and pharmacology.
Formula:C18H22BrNO3
InChI:InChI=1S/C18H22BrNO3/c1-21-16-7-5-4-6-14(16)12-20-9-8-13-10-18(23-3)15(19)11-17(13)22-2/h4-7,10-11,20H,8-9,12H2,1-3H3
InChI key:InChIKey=SUXGNJVVBGJEFB-UHFFFAOYSA-N
SMILES:C(CNCC1=C(OC)C=CC=C1)C2=C(OC)C=C(Br)C(OC)=C2
Synonyms:- Benzeneethanamine, 4-bromo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]-
- 2-(4-Bromo-2,5-dimethoxyphenyl)-N-(2-methoxybenzyl)ethan-1-amine
- 25B-NBOMe
- 4-Bromo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine
- 2-(4-Bromo-2,5-dimethoxyphenyl)-N-(2-methoxybenzyl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Bromo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine
CAS:Controlled ProductApplications 4-Bromo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine is a derivative of 2,5-Dimethoxy-4-bromophenethylamine (D469650). 4-Bromo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine is a potent partial agonist for the 5HT2A receptor.
References Silva, M.E., et al.: J. Comp. Aid. Mol. Design., 25, 51 (2011); Quirino, J., et al.: Science, 282, 465 (1998); de Boer, D., et al.: Pharm. World Sci., 26, 110 (2004); Carmo, H., et al.: Toxicology, 206, 75 (2005); Kanamori, T., et al.: Forensic Sci. Int., 148, 131 (2005);Formula:C18H22BrNO3Color and Shape:NeatMolecular weight:380.2764-Bromo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine-d6 Hydrochloride
CAS:Controlled ProductFormula:C18D6H16BrNO3·HClColor and Shape:NeatMolecular weight:422.774
