CAS 102652-87-9
:Ethanone, 1-(2,4-dimethoxy-3-nitrophenyl)-
Description:
Ethanone, 1-(2,4-dimethoxy-3-nitrophenyl)-, also known by its CAS number 102652-87-9, is an organic compound characterized by its structure, which includes a ketone functional group and a substituted aromatic ring. The presence of the 2,4-dimethoxy and 3-nitro substituents on the phenyl ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar functional groups. Its nitro group can participate in electrophilic aromatic substitution reactions, while the methoxy groups can influence the electronic properties of the aromatic system. The compound's unique combination of functional groups may also impart specific biological activities, making it of interest for further research in medicinal chemistry. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes be sensitive or hazardous.
Formula:C10H11NO5
InChI:InChI=1S/C10H11NO5/c1-6(12)7-4-5-8(15-2)9(11(13)14)10(7)16-3/h4-5H,1-3H3
InChI key:InChIKey=ZGDIGYSVMZINGW-UHFFFAOYSA-N
SMILES:O(C)C1=C(N(=O)=O)C(OC)=CC=C1C(C)=O
Synonyms:- 1-(2,4-Dimethoxy-3-nitrophenyl)ethanone
- Ethanone, 1-(2,4-dimethoxy-3-nitrophenyl)-
- Acetophenone, 2′,4′-dimethoxy-3′-nitro-
- 1-(2,4-Dimethoxy-3-nitrophenyl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
