CAS 10266-45-2

3-(2-Hydroxyethyl)benzeneacetonitrile

Description:

3-(2-Hydroxyethyl)benzeneacetonitrile, with the CAS number 10266-45-2, is an organic compound characterized by its functional groups, which include a nitrile and a hydroxyl group. This compound features a benzene ring substituted with a 2-hydroxyethyl group and an acetonitrile moiety, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility in polar solvents. Additionally, the nitrile group can participate in various chemical reactions, making this compound potentially useful in organic synthesis and pharmaceutical applications. Its molecular structure allows for potential interactions with biological systems, which may be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₁NO

InChI: InChI=1S/C10H11NO/c11-6-4-9-2-1-3-10(8-9)5-7-12/h1-3,8,12H,4-5,7H2

InChI key: InChIKey=DITZZPGZEZJPAB-UHFFFAOYSA-N

SMILES: C(C#N)C1=CC(CCO)=CC=C1

Synonyms:

• Acetonitrile, [m-(2-hydroxyethyl)phenyl]-
• Benzeneacetonitrile, 3-(2-hydroxyethyl)-
• 2-[3-(2-Hydroxyethyl)phenyl]acetonitrile
• 3-(2-Hydroxyethyl)benzeneacetonitrile