CAS 102672-57-1

1-Iodoethyl cyclohexyl carbonate

Description:

1-Iodoethyl cyclohexyl carbonate, with the CAS number 102672-57-1, is an organic compound characterized by the presence of both an iodoalkyl group and a carbonate functional group. This compound typically appears as a colorless to pale yellow liquid, exhibiting moderate volatility. Its molecular structure includes a cyclohexyl ring, which contributes to its hydrophobic properties, while the iodoethyl moiety enhances its reactivity, particularly in nucleophilic substitution reactions. The carbonate group imparts stability and can participate in various chemical transformations, making it useful in organic synthesis. Additionally, the presence of iodine in the structure may provide opportunities for further functionalization or coupling reactions. The compound's solubility is generally limited in water but may dissolve in organic solvents, which is typical for many carbonate esters. Safety considerations should be taken into account due to the potential reactivity of the iodine atom, and appropriate handling procedures should be followed in laboratory settings. Overall, 1-Iodoethyl cyclohexyl carbonate is a versatile compound with applications in synthetic organic chemistry.

Formula: C₉H₁₅IO₃

InChI: InChI=1/C9H15IO3/c1-7(10)12-9(11)13-8-5-3-2-4-6-8/h7-8H,2-6H2,1H3

SMILES: CC(I)OC(=O)OC1CCCCC1

Synonyms:

• 1-Iodoethyl Cyclohexyl Carbonate (JCC-5)
• Cyclohexyl1-Iodoethylcarbonate
• Cyclohexyl 1-Iodoethyl Carbonate

Carbonic acid,cyclohexyl 1-iodoethyl ester

CAS: 102672-57-1

Formula: C₉H₁₅IO₃

Molecular weight: 298.1181

Ref: IN-DA000832