CAS 102674-12-4
:(4Z,7R,8E,10E,12Z,14S)-7,14-Dihydroxy-4,8,10,12-octadecatetraenedioic acid
Description:
(4Z,7R,8E,10E,12Z,14S)-7,14-Dihydroxy-4,8,10,12-octadecatetraenedioic acid, with CAS number 102674-12-4, is a polyunsaturated fatty acid characterized by multiple double bonds and hydroxyl groups in its structure. This compound features a long carbon chain typical of fatty acids, with specific geometric configurations indicated by the Z and E nomenclature, which refer to the spatial arrangement of substituents around the double bonds. The presence of hydroxyl groups contributes to its potential reactivity and solubility in polar solvents, influencing its biological activity and interactions with other molecules. Such compounds are often studied for their roles in biological systems, including their potential effects on cell signaling and membrane fluidity. Additionally, the specific stereochemistry of this molecule may affect its biological function and interactions with enzymes or receptors. Overall, this compound exemplifies the complexity and diversity of fatty acids, particularly those with multiple functional groups and unsaturation.
Formula:C18H26O6
InChI:InChI=1/C18H26O6/c19-15(11-6-3-7-13-17(21)22)9-4-1-2-5-10-16(20)12-8-14-18(23)24/h1-6,9-10,15-16,19-20H,7-8,11-14H2,(H,21,22)(H,23,24)/b2-1+,6-3-,9-4+,10-5-/t15-,16+/m0/s1
InChI key:InChIKey=XWRIIHRGMKHPHN-USRRKILKSA-N
SMILES:[C@H](/C=C/C=C/C=C\[C@H](CCCC(O)=O)O)(C/C=C\CCC(O)=O)O
Synonyms:- (4Z,7R,8E,10E,12Z,14S)-7,14-Dihydroxy-4,8,10,12-octadecatetraenedioic acid
- (4Z,7R,8E,10E,12Z,14S)-7,14-dihydroxyoctadeca-4,8,10,12-tetraenedioic acid
- 18-Cooh-19,20-ltb4
- 4,8,10,12-Octadecatetraenedioic acid, 7,14-dihydroxy-, (4Z,7R,8E,10E,12Z,14S)-
- 4,8,10,12-Octadecatetraenedioic acid, 7,14-dihydroxy-, (S-(R*,S*-(E,Z,E,Z)))-
- 18-Carboxy-19,20-dinorleukotriene B4
- 18-hydroxy-18-oxo-dinorleukotriene B4
- XWRIIHRGMKHPHN-USRRKILKSA-N
- 18-carboxy dinor Leukotriene B4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
18-carboxy dinor Leukotriene B4
CAS:<p>18-Carboxy dinor Leukotriene B4 (18-carboxy dinor LTB4) represents a β-oxidation metabolite of Leukotriene B4 (LTB4). Initially, LTB4 is metabolized in the liver to 20-carboxy LTB4, which subsequently undergoes β-oxidation to form 18-carboxy dinor LTB4.</p>Formula:C18H26O6Color and Shape:SolidMolecular weight:338.4

