CAS 102677-75-8
:Benzenemethanamine, 3-amino-5-chloro-, hydrochloride (1:2)
Description:
Benzenemethanamine, 3-amino-5-chloro-, hydrochloride (1:2), commonly referred to as a hydrochloride salt, is an organic compound characterized by the presence of an amino group and a chloro substituent on a benzene ring. The compound features a primary amine functional group, which contributes to its basicity and reactivity, particularly in forming salts with acids, such as hydrochloric acid. The chloro substituent at the 5-position of the benzene ring influences the compound's electronic properties and can affect its reactivity in various chemical reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C7H9ClN2·2ClH
InChI:InChI=1S/C7H9ClN2.2ClH/c8-6-1-5(4-9)2-7(10)3-6;;/h1-3H,4,9-10H2;2*1H
InChI key:InChIKey=BXSBXNHFVUMBOZ-UHFFFAOYSA-N
SMILES:C(N)C1=CC(Cl)=CC(N)=C1.Cl
Synonyms:- Benzenemethanamine, 3-amino-5-chloro-, dihydrochloride
- Benzenemethanamine, 3-amino-5-chloro-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
