CymitQuimica logo

CAS 1026787-90-5

:

4,6-Dichloro-2-(1-methylethoxy)pyrimidine

Description:
4,6-Dichloro-2-(1-methylethoxy)pyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 1 and 3 positions. This compound features two chlorine substituents at the 4 and 6 positions, contributing to its reactivity and potential applications in various chemical processes. The presence of the 1-methylethoxy group at the 2 position enhances its solubility and may influence its biological activity. Typically, compounds like this are of interest in the fields of pharmaceuticals and agrochemicals, often serving as intermediates or active ingredients. The molecular structure suggests potential interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, its physical properties, such as melting point, boiling point, and solubility, would be influenced by the functional groups present, which are critical for understanding its behavior in different environments. Safety data and handling precautions should be considered due to the presence of chlorine atoms, which can pose health and environmental risks.
Formula:C7H8Cl2N2O
InChI:InChI=1S/C7H8Cl2N2O/c1-4(2)12-7-10-5(8)3-6(9)11-7/h3-4H,1-2H3
InChI key:InChIKey=RPDPXJQVOKRAAK-UHFFFAOYSA-N
SMILES:O(C(C)C)C=1N=C(Cl)C=C(Cl)N1
Synonyms:
  • Pyrimidine, 4,6-dichloro-2-(1-methylethoxy)-
  • 4,6-Dichloro-2-(1-methylethoxy)pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.