CymitQuimica logo

CAS 1026796-48-4

:

1-(1,3-Benzodioxol-5-yl)cyclobutanemethanamine

Description:
1-(1,3-Benzodioxol-5-yl)cyclobutanemethanamine, identified by its CAS number 1026796-48-4, is a chemical compound that features a cyclobutane ring substituted with an amine group and a benzodioxole moiety. This structure suggests that it may exhibit interesting pharmacological properties due to the presence of both the cyclic and aromatic components. The benzodioxole group is known for its potential biological activity, often associated with compounds that can interact with various receptors or enzymes in biological systems. The cyclobutane ring contributes to the compound's three-dimensional shape, which can influence its reactivity and interaction with biological targets. Additionally, the amine functional group may participate in hydrogen bonding and other interactions, enhancing the compound's solubility and reactivity. Overall, the unique combination of these structural features may lead to diverse applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c13-7-12(4-1-5-12)9-2-3-10-11(6-9)15-8-14-10/h2-3,6H,1,4-5,7-8,13H2
InChI key:InChIKey=VOXZHTBTICSXLI-UHFFFAOYSA-N
SMILES:C(N)C1(CCC1)C=2C=C3C(=CC2)OCO3
Synonyms:
  • Cyclobutanemethanamine, 1-(1,3-benzodioxol-5-yl)-
  • 1-(1,3-Benzodioxol-5-yl)cyclobutanemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.