CAS 1026796-51-9

Phenol, 3-bromo-2-fluoro-5-methyl-

Description:

Phenol, 3-bromo-2-fluoro-5-methyl- is an organic compound characterized by the presence of a hydroxyl group (-OH) attached to a benzene ring, which is further substituted with a bromine atom at the meta position, a fluorine atom at the ortho position, and a methyl group at the para position. This compound belongs to the class of halogenated phenols, which are known for their diverse applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of both bromine and fluorine introduces unique reactivity and polarity, potentially influencing its solubility and interaction with biological systems. The methyl group contributes to the hydrophobic character of the molecule, while the halogen substituents can enhance its electrophilic properties. Overall, the specific arrangement of these substituents affects the compound's chemical behavior, stability, and potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₇H₆BrFO

InChI: InChI=1S/C7H6BrFO/c1-4-2-5(8)7(9)6(10)3-4/h2-3,10H,1H3

InChI key: InChIKey=QHVGXKWNWNRIIM-UHFFFAOYSA-N

SMILES: FC1=C(Br)C=C(C)C=C1O

Synonyms:

• 3-Bromo-2-fluoro-5-methylphenol
• Phenol, 3-bromo-2-fluoro-5-methyl-

Phenol, 3-bromo-2-fluoro-5-methyl-

CAS: 1026796-51-9

Formula: C₇H₆BrFO

Purity: 95%

Molecular weight: 205.0243

Ref: IN-DA000838

3-Bromo-2-fluoro-5-methylphenol

CAS: 1026796-51-9

3-Bromo-2-fluoro-5-methylphenol

Formula: C₇H₆BrFO

Purity: 98%

Color and Shape: beige solid

Molecular weight: 205.02g/mol

Ref: 54-PC900033

3-Bromo-2-fluoro-5-methylphenol

CAS: 1026796-51-9

Formula: C₇H₆BrFO

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 205.026

Ref: 10-F216253