
CAS 1026796-53-1
:3-Bromo-2-(1-methylethoxy)phenol
Description:
3-Bromo-2-(1-methylethoxy)phenol is an organic compound characterized by the presence of a bromine atom and a methylethoxy group attached to a phenolic structure. This compound features a phenol ring, which is known for its hydroxyl (-OH) group that contributes to its reactivity and potential applications in various chemical processes. The bromine substituent enhances the compound's electrophilic properties, making it useful in further chemical transformations, such as nucleophilic substitutions. The methylethoxy group introduces steric hindrance and can influence the compound's solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. Additionally, the presence of both bromine and the methylethoxy group can affect the compound's physical properties, such as melting point, boiling point, and solubility in different solvents. Overall, 3-Bromo-2-(1-methylethoxy)phenol is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C9H11BrO2
InChI:InChI=1S/C9H11BrO2/c1-6(2)12-9-7(10)4-3-5-8(9)11/h3-6,11H,1-2H3
InChI key:InChIKey=OSULYEKTMXRPSA-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=C(Br)C=CC=C1O
Synonyms:- 3-Bromo-2-(1-methylethoxy)phenol
- Phenol, 3-bromo-2-(1-methylethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.