
CAS 1026797-09-0
:4,4,5,5-Tetramethyl-2-[4-[(2,2,2-trifluoroethyl)thio]phenyl]-1,3,2-dioxaborolane
Description:
4,4,5,5-Tetramethyl-2-[4-[(2,2,2-trifluoroethyl)thio]phenyl]-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structure, which includes a dioxaborolane ring and a trifluoroethylthio substituent. This compound typically exhibits properties associated with boron compounds, such as potential reactivity in organic synthesis and applications in materials science. The presence of the trifluoroethyl group may impart hydrophobic characteristics and enhance stability against hydrolysis, making it suitable for various chemical applications. Additionally, the tetramethyl groups contribute to steric hindrance, which can influence the compound's reactivity and solubility in organic solvents. The compound's structure suggests potential utility in medicinal chemistry, particularly in the development of boron-based drugs or as a reagent in cross-coupling reactions. Overall, its unique combination of functional groups and structural features makes it a compound of interest in both academic and industrial research settings.
Formula:C14H18BF3O2S
InChI:InChI=1S/C14H18BF3O2S/c1-12(2)13(3,4)20-15(19-12)10-5-7-11(8-6-10)21-9-14(16,17)18/h5-8H,9H2,1-4H3
InChI key:InChIKey=IWQZEFMFJNCWMQ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(SCC(F)(F)F)C=C2
Synonyms:- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-[(2,2,2-trifluoroethyl)thio]phenyl]-
- 4,4,5,5-Tetramethyl-2-[4-[(2,2,2-trifluoroethyl)thio]phenyl]-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.