CAS 10268-76-5

N,N′-1,2-Phenylenebis[propanamide]

Description:

N,N′-1,2-Phenylenebis[propanamide], with the CAS number 10268-76-5, is an organic compound characterized by its amide functional groups and a biphenyl structure. This substance features two propanamide groups attached to a 1,2-phenylenediamine backbone, which contributes to its potential applications in various fields, including pharmaceuticals and materials science. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. The presence of amide linkages suggests that it may participate in hydrogen bonding, influencing its physical properties and reactivity. Additionally, the compound's stability and behavior under different environmental conditions can be significant for its practical applications. Safety data should be consulted to understand its toxicity and handling requirements, as with any chemical substance. Overall, N,N′-1,2-Phenylenebis[propanamide] represents a unique structure with potential utility in various chemical and biological contexts.

Formula: C₁₂H₁₆N₂O₂

InChI: InChI=1S/C12H16N2O2/c1-3-11(15)13-9-7-5-6-8-10(9)14-12(16)4-2/h5-8H,3-4H2,1-2H3,(H,13,15)(H,14,16)

InChI key: InChIKey=HWGNLPYYGYTREU-UHFFFAOYSA-N

SMILES: N(C(CC)=O)C1=C(NC(CC)=O)C=CC=C1

Synonyms:

• N,N′-1,2-Phenylenebis[propanamide]
• Propionamide, N,N′-o-phenylenebis-
• Propanamide, N,N′-1,2-phenylenebis-

Propanamide, N,N'-1,2-phenylenebis-

CAS: 10268-76-5

Formula: C₁₂H₁₆N₂O₂

Molecular weight: 220.2676

Ref: IN-DA00084B