CAS 102681-52-7
:Benzo(3,4)cycloocta(1,2-f)(1,3)benzodioxol-1-ol, 5,6,7,8-tetrahydro-2, 3,13-trimethoxy-6,7-dimethyl-, stereoisomer
Description:
Benzo(3,4)cycloocta(1,2-f)(1,3)benzodioxol-1-ol, 5,6,7,8-tetrahydro-2,3,13-trimethoxy-6,7-dimethyl-, is a complex organic compound characterized by its polycyclic structure, which includes fused benzene rings and a dioxole moiety. This compound features multiple methoxy groups, contributing to its chemical reactivity and potential biological activity. The presence of hydroxyl (-OH) groups indicates that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. The stereoisomer designation suggests that the compound can exist in different spatial arrangements, which may affect its pharmacological properties and interactions with biological targets. Its molecular structure implies potential applications in medicinal chemistry, particularly in the development of compounds with therapeutic effects. Additionally, the compound's unique arrangement of substituents may lead to interesting optical properties, making it a subject of interest in materials science and organic synthesis. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.
Formula:C22H26O6
InChI:InChI=1/C22H26O6/c1-11-6-13-8-15(24-3)20(25-4)19(23)17(13)18-14(7-12(11)2)9-16-21(22(18)26-5)28-10-27-16/h8-9,11-12,23H,6-7,10H2,1-5H3/t11-,12+/m1/s1
Synonyms:- schisanhenol B
- (6R,7S)-2,3,13-trimethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzo(3,4)cycloocta(1,2-f)(1,3)benzodioxol-1-ol, 5,6,7,8-tetrahydro-2, 3,13-trimethoxy-6,7-dimethyl-, stereoisomer
CAS:Formula:C22H26O6Purity:98.0%Molecular weight:386.4382Schisanhenol B
CAS:Schisanhenol B is a natural product from Schisandra chinensis (Turcz.) Baill.Formula:C22H26O6Purity:98%Color and Shape:SolidMolecular weight:386.44Schisanhenol B
CAS:Controlled Product<p>Schisanhenol B is a bioactive compound that has potent inhibitory activity against the enzyme tyrosinase. Tyrosinase is an enzyme that catalyzes the first step in melanin synthesis and its inhibition leads to decreased melanin production. Schisanhenol B also has been shown to inhibit other enzymes, such as fructosyltransferases, which are involved in the synthesis of polysaccharides and glycoproteins. The structural formula of schisanhenol B is biphenyl. This compound has been found to be effective against human liver cells and in vitro assays, with a reported effective dose of 0.1-0.5 μM.</p>Formula:C22H26O6Purity:Min. 95%Molecular weight:386.4 g/mol




