CAS 102692-36-4

(2E)-1-[1,1′-Biphenyl]-4-yl-3-(4-methylphenyl)-2-propen-1-one

Description:

The chemical substance known as (2E)-1-[1,1′-Biphenyl]-4-yl-3-(4-methylphenyl)-2-propen-1-one, with the CAS number 102692-36-4, is an organic compound characterized by its structure, which features a conjugated system that includes a propenone moiety. This compound exhibits properties typical of chalcones, such as potential antioxidant and anti-inflammatory activities. Its biphenyl and methylphenyl substituents contribute to its hydrophobic characteristics, influencing its solubility in organic solvents. The presence of the double bond in the propenone structure allows for potential reactivity, including electrophilic addition and polymerization. Additionally, the compound may exhibit UV-Vis absorbance due to its conjugated double bond system, making it of interest in photochemical applications. Its structural features suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, this compound exemplifies the diverse chemistry of chalcones and their derivatives, with implications in various fields, including pharmaceuticals and materials science.

Formula: C₂₂H₁₈O

InChI: InChI=1S/C22H18O/c1-17-7-9-18(10-8-17)11-16-22(23)21-14-12-20(13-15-21)19-5-3-2-4-6-19/h2-16H,1H3/b16-11+

InChI key: InChIKey=JTSGWWQKGVNALD-LFIBNONCSA-N

SMILES: C(/C=C/C1=CC=C(C)C=C1)(=O)C2=CC=C(C=C2)C3=CC=CC=C3

Synonyms:

• 2-Propen-1-one, 1-[1,1′-biphenyl]-4-yl-3-(4-methylphenyl)-, (2E)-
• 2-Propen-1-one, 1-[1,1′-biphenyl]-4-yl-3-(4-methylphenyl)-, (E)-
• (2E)-1-[1,1′-Biphenyl]-4-yl-3-(4-methylphenyl)-2-propen-1-one

(2E)-1-[1,1′-Biphenyl]-4-yl-3-(4-methylphenyl)-2-propen-1-one

CAS: 102692-36-4

Formula: C₂₂H₁₈O

Molecular weight: 298.3777

Ref: IN-DA00084J

(2E)-1-{[1,1'-biphenyl]-4-yl}-3-(4-methylphenyl)prop-2-en-1-one

CAS: 102692-36-4

Purity: 95.0%

Molecular weight: 298.385009765625

Ref: 10-F524224