CAS 102692-38-6

2-Propen-1-one, 1-[1,1'-biphenyl]-4-yl-3-(4-methoxyphenyl)-, (E)-

Description:

2-Propen-1-one, 1-[1,1'-biphenyl]-4-yl-3-(4-methoxyphenyl)-, (E)-, also known by its CAS number 102692-38-6, is an organic compound characterized by its conjugated double bond system, which contributes to its reactivity and potential applications in organic synthesis. This compound features a biphenyl moiety and a methoxy-substituted phenyl group, indicating a degree of structural complexity that may influence its physical and chemical properties. Typically, such compounds exhibit properties like moderate to high melting and boiling points, depending on their molecular weight and intermolecular interactions. The presence of the methoxy group can enhance solubility in organic solvents and may also affect the compound's electronic properties, making it a candidate for applications in materials science, particularly in the development of organic light-emitting diodes (OLEDs) and other electronic devices. Additionally, the (E)-configuration suggests a specific geometric arrangement around the double bond, which can play a crucial role in the compound's reactivity and interaction with other molecules.

Formula: C₂₂H₁₈O₂

InChI: InChI=1S/C22H18O2/c1-24-21-14-7-17(8-15-21)9-16-22(23)20-12-10-19(11-13-20)18-5-3-2-4-6-18/h2-16H,1H3/b16-9+

InChI key: InChIKey=MNESAXRIWTZNSF-CXUHLZMHSA-N

SMILES: C(/C=C/C1=CC=C(OC)C=C1)(=O)C2=CC=C(C=C2)C3=CC=CC=C3

(2E)-1-{[1,1'-biphenyl]-4-yl}-3-(4-methoxyphenyl)prop-2-en-1-one

CAS: 102692-38-6

Purity: 95.0%

Molecular weight: 314.3840026855469

Ref: 10-F524220