CAS 102696-71-9
:(2E)-3-(3-Thienyl)-2-propenoic acid
Description:
(2E)-3-(3-Thienyl)-2-propenoic acid, also known as thienyl acrylic acid, is an organic compound characterized by its unique structure that includes a thienyl group attached to an acrylic acid moiety. This compound features a double bond between the second and third carbon atoms, which contributes to its reactivity and potential applications in organic synthesis. The thienyl group, derived from thiophene, imparts distinct electronic properties, making the compound of interest in various chemical reactions and materials science. It is typically a solid at room temperature and exhibits solubility in organic solvents. The presence of the carboxylic acid functional group allows for hydrogen bonding and enhances its reactivity, particularly in esterification and amidation reactions. Additionally, (2E)-3-(3-Thienyl)-2-propenoic acid may exhibit biological activity, making it a candidate for further research in pharmaceuticals or agrochemicals. Its unique structural features and potential applications make it a valuable compound in both academic and industrial chemistry contexts.
Formula:C7H6O2S
InChI:InChI=1S/C7H6O2S/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1+
InChI key:InChIKey=VYRYYUKILKRGDN-OWOJBTEDSA-N
SMILES:C(=C/C(O)=O)\C=1C=CSC1
Synonyms:- (2E)-3-(3-Thienyl)-2-propenoic acid
- (2E)-3-(thiophen-3-yl)prop-2-enoic acid
- (E)-3-(3-Thienyl)-2-propenoic acid
- 2-Propenoic acid, 3-(3-thienyl)-, (2E)-
- 2-Propenoic acid, 3-(3-thienyl)-, (E)-
- 3-(3-Thienyl)acrylic acid
- trans-3-(Thiophen-3-yl)acrylic acid
- trans-3-(3-Thienyl)acrylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
trans-3-(3-Thienyl)acrylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H6O2SPurity:98%Color and Shape:White, PowderMolecular weight:154.182-Propenoic acid, 3-(3-thienyl)-, (2E)-
CAS:Formula:C7H6O2SPurity:97%Color and Shape:SolidMolecular weight:154.1863(E)-3-(Thiophen-3-yl)acrylic acid
CAS:(E)-3-(Thiophen-3-yl)acrylic acidPurity:97%Molecular weight:154.19g/mol3-Thien-3-ylacrylic acid
CAS:Formula:C7H6O2SPurity:99%(LC-MS);RGColor and Shape:SolidMolecular weight:154.183-(3-Thienyl)acrylic Acid
CAS:Controlled ProductApplications 3-(3-THIENYL)ACRYLIC ACID (cas# 102696-71-9) is a useful research chemical.
Formula:C7H6O2SColor and Shape:NeatMolecular weight:154.19




