CAS 1027-01-6

2-phenylimidazo[1,2-a]pyridine-6-carboxylic acid

Description:

2-Phenylimidazo[1,2-a]pyridine-6-carboxylic acid, with the CAS number 1027-01-6, is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, along with a phenyl group and a carboxylic acid functional group. This compound typically exhibits a solid state at room temperature and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the carboxylic acid group contributes to its acidity and solubility in polar solvents, while the aromatic rings enhance its stability and electronic properties. Its structure allows for various interactions, making it a subject of interest in medicinal chemistry and drug development. Additionally, the compound may participate in hydrogen bonding and π-π stacking interactions due to its aromatic nature, which can influence its reactivity and interactions with biological targets. Overall, 2-phenylimidazo[1,2-a]pyridine-6-carboxylic acid is a versatile compound with significant implications in pharmaceutical research.

Formula: C₁₄H₁₀N₂O₂

InChI: InChI=1/C14H10N2O2/c17-14(18)11-6-7-13-15-12(9-16(13)8-11)10-4-2-1-3-5-10/h1-9H,(H,17,18)

SMILES: c1ccc(cc1)c1cn2cc(ccc2n1)C(=O)O

2-phenylimidazo[1,2-a]pyridine-6-carboxylic acid

CAS: 1027-01-6

Formula: C₁₄H₁₀N₂O₂

Molecular weight: 238.2414

Ref: IN-DA00085S

2-Phenylimidazo[1,2-a]pyridine-6-carboxylic acid

CAS: 1027-01-6

2-Phenylimidazo[1,2-a]pyridine-6-carboxylic acid

Purity: 97%

Molecular weight: 238.25g/mol

Ref: 54-OR1055536