CAS 1027-94-7
:4-[(1-Methylethyl)amino]-1-(phenylmethyl)-4-piperidinecarbonitrile
Description:
4-[(1-Methylethyl)amino]-1-(phenylmethyl)-4-piperidinecarbonitrile, commonly referred to by its CAS number 1027-94-7, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a phenylmethyl group and an isopropylamino group. This compound typically exhibits properties associated with piperidine derivatives, such as being a colorless to pale yellow solid or liquid, depending on its form and purity. It is known for its potential biological activity, particularly in pharmacological applications, where it may act as a ligand for various receptors. The presence of the carbonitrile functional group contributes to its reactivity and potential for further chemical modifications. Additionally, the compound's molecular structure suggests it may exhibit lipophilicity, influencing its solubility in organic solvents. Safety data should be consulted for handling and exposure risks, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C16H23N3
InChI:InChI=1S/C16H23N3/c1-14(2)18-16(13-17)8-10-19(11-9-16)12-15-6-4-3-5-7-15/h3-7,14,18H,8-12H2,1-2H3
InChI key:InChIKey=AFWVUHFFBULMAW-UHFFFAOYSA-N
SMILES:N(C(C)C)C1(C#N)CCN(CC2=CC=CC=C2)CC1
Synonyms:- NSC 73000
- 4-Piperidinecarbonitrile, 4-[(1-methylethyl)amino]-1-(phenylmethyl)-
- Isonipecotonitrile, 1-benzyl-4-(isopropylamino)-
- 4-[(1-Methylethyl)amino]-1-(phenylmethyl)-4-piperidinecarbonitrile
- 1-Benzyl-4-(isopropylamino)piperidine-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
