CAS 10270-29-8
:4-pentylbenzonitrile
Description:
4-Pentylbenzonitrile, with the CAS number 10270-29-8, is an organic compound characterized by a benzene ring substituted with a pentyl group and a nitrile functional group. Its molecular structure features a long hydrophobic pentyl chain attached to the para position of the benzene ring, which influences its physical properties, such as solubility and melting point. The presence of the nitrile group (-C≡N) contributes to its polarity and can affect its reactivity, making it a useful intermediate in organic synthesis. Typically, 4-pentylbenzonitrile is a colorless to pale yellow liquid or solid, depending on the temperature, and it exhibits moderate volatility. It is often utilized in the production of liquid crystals and as a solvent or reagent in various chemical reactions. Additionally, its unique structure allows for potential applications in materials science and pharmaceuticals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C12H15N
InChI:InChI=1/C12H15N/c1-2-3-4-5-11-6-8-12(10-13)9-7-11/h6-9H,2-5H2,1H3
SMILES:CCCCCc1ccc(cc1)C#N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Pentylbenzonitrile
CAS:<p>4-Pentylbenzonitrile is a reactive chemical that can be used in the synthesis of pharmaceuticals, polymers, and dyes. It is an anion that is reductively activated to form the radical anion. The radical anion can react with alkynes to form alkyl radicals, which are then reduced to alkyl groups. This reaction is used in the synthesis of some drugs, such as clozapine. 4-Pentylbenzonitrile may also be used as a source of cyano group for other reactions, such as reductive alkylation and aromatic nitration.</p>Formula:C12H15NPurity:Min. 95%Color and Shape:PowderMolecular weight:173.25 g/mol


