CAS 10271-85-9

5-Isothiazolecarboxylic acid

Description:

5-Isothiazolecarboxylic acid is a heterocyclic compound characterized by the presence of an isothiazole ring, which consists of a five-membered ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) attached to the isothiazole structure, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. The presence of the isothiazole moiety imparts unique chemical reactivity, making it useful in various applications, including pharmaceuticals and agrochemicals. Its derivatives may exhibit biological activity, such as antimicrobial or antifungal properties. Additionally, 5-isothiazolecarboxylic acid can participate in various chemical reactions, including esterification and amidation, allowing for the synthesis of more complex molecules. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound is of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₄H₃NO₂S

InChI: InChI=1/C4H3NO2S/c6-4(7)3-1-2-5-8-3/h1-2H,(H,6,7)

InChI key: InChIKey=GGYXPOOZYZHPLB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=NS1

Synonyms:

• 1,2-Thiazole-5-carboxylic acid
• Isothiazole-5-Carboxylic Acid
• 5-Isothiazolecarboxylic acid
• 8-Isoquinoline-methaneaminedihydrochloride

Isothiazole-5-carboxylic acid

CAS: 10271-85-9

Formula: C₄H₃NO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 129.13

Ref: 10-F040059

5-ISOTHIAZOLECARBOXYLIC ACID

CAS: 10271-85-9

Formula: C₄H₃NO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 129.1371

Ref: IN-DA00086X

Isothiazole-5-carboxylic acid

CAS: 10271-85-9

Isothiazole-5-carboxylic acid

Purity: 98%

Molecular weight: 129.14g/mol

Ref: 54-OR313078