CAS 10271-85-9: 5-Isothiazolecarboxylic acid
Description:5-Isothiazolecarboxylic acid is a heterocyclic compound characterized by the presence of an isothiazole ring, which consists of a five-membered ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) attached to the isothiazole structure, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. The presence of the isothiazole moiety imparts unique chemical reactivity, making it useful in various applications, including pharmaceuticals and agrochemicals. Its derivatives may exhibit biological activity, such as antimicrobial or antifungal properties. Additionally, 5-isothiazolecarboxylic acid can participate in various chemical reactions, including esterification and amidation, allowing for the synthesis of more complex molecules. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound is of interest in both synthetic chemistry and medicinal chemistry research.
Formula:C4H3NO2S
InChI:InChI=1S/C4H3NO2S/c6-4(7)3-1-2-5-8-3/h1-2H,(H,6,7)
InChI key:InChIKey=GGYXPOOZYZHPLB-UHFFFAOYSA-N
SMILES:O=C(O)C=1SN=CC1
- Synonyms:
- 1,2-Thiazole-5-carboxylic acid
- Isothiazole-5-Carboxylic Acid
- 5-Isothiazolecarboxylic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 5-ISOTHIAZOLECARBOXYLIC ACID REF: IN-DA00086XCAS: 10271-85-9 | 97% | To inquire | Tue 04 Mar 25 |
 | Isothiazole-5-carboxylic acid REF: 54-OR313078CAS: 10271-85-9 | 98% | 32.00 €~2,755.00 € | Mon 03 Mar 25 |
 | Isothiazole-5-carboxylic acid REF: 10-F040059CAS: 10271-85-9 | 97.0% | 34.00 €~609.00 € | Wed 05 Mar 25 |
 | Isothiazole-5-carboxylic acid REF: 3D-FI10570CAS: 10271-85-9 | Min. 95% | - - - | Discontinued product |
5-ISOTHIAZOLECARBOXYLIC ACID
Ref: IN-DA00086X
| 1g | 101.00 € | ||
| 5g | 304.00 € | ||
| 25g | To inquire | ||
| 100mg | 27.00 € | ||
| 250mg | 53.00 € |
Ref: 54-OR313078
| 1g | 140.00 € | ||
| 5g | 611.00 € | ||
| 25g | 2,755.00 € | ||
| 100mg | 32.00 € | ||
| 250mg | 42.00 € |
Isothiazole-5-carboxylic acid
Ref: 10-F040059
| 1g | 97.00 € | ||
| 5g | 323.00 € | ||
| 10g | 609.00 € | ||
| 250mg | 34.00 € |
Isothiazole-5-carboxylic acid
Ref: 3D-FI10570
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
