CAS 10271-93-9

4-Isothiazoleacetic acid

Description:

4-Isothiazoleacetic acid is a heterocyclic organic compound characterized by its isothiazole ring structure, which features a five-membered ring containing both sulfur and nitrogen atoms. This compound is typically a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. It exhibits acidic properties due to the presence of the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. 4-Isothiazoleacetic acid is known for its biological activity, often being studied for its potential as a pharmaceutical intermediate or in agrochemical applications. Its unique structure allows it to interact with biological systems, which may lead to various pharmacological effects. Additionally, the compound's stability and reactivity can be influenced by environmental factors, such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 4-Isothiazoleacetic acid is a significant compound in both synthetic chemistry and biological research.

Formula: C₅H₅NO₂S

InChI: InChI=1S/C5H5NO2S/c7-5(8)1-4-2-6-9-3-4/h2-3H,1H2,(H,7,8)

InChI key: InChIKey=AVKFDJHAYWIHMX-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=NSC1

Synonyms:

• 2-(Isothiazol-4-yl)acetic acid
• 2-(1,2-Thiazol-4-yl)acetic acid
• 4-Isothiazoleacetic acid

2-(1,2-thiazol-4-yl)acetic acid

CAS: 10271-93-9

Formula: C₅H₅NO₂S

Molecular weight: 143.1637

Ref: IN-DA00086T

2-(1,2-Thiazol-4-yl)acetic acid

CAS: 10271-93-9

Versatile small molecule scaffold

Formula: C₅H₅NO₂S

Purity: Min. 95%

Molecular weight: 143.17 g/mol

Ref: 3D-KAA27193