CAS 1027161-33-6

2,5-Dimethoxy-N-[(2-methoxyphenyl)methyl]-4-(trifluoromethyl)benzeneethanamine

Description:

2,5-Dimethoxy-N-[(2-methoxyphenyl)methyl]-4-(trifluoromethyl)benzeneethanamine, identified by its CAS number 1027161-33-6, is a synthetic organic compound that belongs to the class of phenethylamines. This compound features a complex structure characterized by the presence of two methoxy groups, a trifluoromethyl group, and an ethylamine moiety. The methoxy groups contribute to its potential for increased lipophilicity, which may influence its biological activity and interaction with various receptors. The trifluoromethyl group is known to enhance metabolic stability and can affect the compound's electronic properties. This substance may exhibit psychoactive properties, similar to other phenethylamines, and is of interest in medicinal chemistry for its potential therapeutic applications. However, detailed studies on its pharmacological effects, toxicity, and safety profile are necessary to fully understand its implications in research and potential use. As with many synthetic compounds, proper handling and adherence to safety protocols are essential due to the unknown effects of novel substances.

Formula: C₁₉H₂₂F₃NO₃

InChI: InChI=1S/C19H22F3NO3/c1-24-16-7-5-4-6-14(16)12-23-9-8-13-10-18(26-3)15(19(20,21)22)11-17(13)25-2/h4-7,10-11,23H,8-9,12H2,1-3H3

InChI key: InChIKey=FBHVTQIAHOTPAM-UHFFFAOYSA-N

SMILES: C(CNCC1=C(OC)C=CC=C1)C2=C(OC)C=C(C(F)(F)F)C(OC)=C2

Synonyms:

• Benzeneethanamine, 2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]-4-(trifluoromethyl)-
• 2,5-Dimethoxy-N-[(2-methoxyphenyl)methyl]-4-(trifluoromethyl)benzeneethanamine