CAS 1027169-94-3

4-Bromo-1-hydroxy-2(1H)-pyridinone

Description:

4-Bromo-1-hydroxy-2(1H)-pyridinone, identified by its CAS number 1027169-94-3, is a heterocyclic organic compound featuring a pyridinone structure. This compound is characterized by the presence of a bromine atom at the 4-position and a hydroxyl group at the 1-position of the pyridine ring. It typically exhibits a pale to light-colored appearance and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The compound may display biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure allows for potential interactions with various biological targets, and it may be involved in chelation processes due to the presence of the carbonyl and hydroxyl functionalities. Additionally, the bromine substituent can influence the compound's reactivity and stability, potentially affecting its application in synthetic pathways or as a pharmaceutical agent. Overall, 4-Bromo-1-hydroxy-2(1H)-pyridinone is a compound of interest for further research in various chemical and biological contexts.

Formula: C₅H₄BrNO₂

InChI: InChI=1S/C5H4BrNO2/c6-4-1-2-7(9)5(8)3-4/h1-3,9H

InChI key: InChIKey=JKFHYQMFYCGEHF-UHFFFAOYSA-N

SMILES: O=C1N(O)C=CC(Br)=C1

Synonyms:

• 4-Bromo-1-hydroxy-2(1H)-pyridinone
• 2(1H)-Pyridinone, 4-bromo-1-hydroxy-