CAS 10272-10-3
:2-Amino-4,6-dimethyl-1,3-benzenedicarbonitrile
Description:
2-Amino-4,6-dimethyl-1,3-benzenedicarbonitrile, with the CAS number 10272-10-3, is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two cyano groups and an amino group. The presence of the amino group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. The two methyl groups contribute to its hydrophobic character, potentially affecting its interactions with other molecules. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. Its physical properties, such as melting point and boiling point, are influenced by the functional groups present and the overall molecular structure. Additionally, the presence of cyano groups suggests that it may exhibit certain electronic properties, making it a candidate for applications in materials science or as a building block in complex organic synthesis. Safety data should be consulted for handling and storage, as compounds with cyano groups can be toxic and require careful management.
Formula:C10H9N3
InChI:InChI=1S/C10H9N3/c1-6-3-7(2)9(5-12)10(13)8(6)4-11/h3H,13H2,1-2H3
InChI key:InChIKey=MMZNMKQTEGNFOB-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N)C(C#N)=C(C)C=C1C
Synonyms:- 1,3-Benzenedicarbonitrile, 2-amino-4,6-dimethyl-
- 2-Amino-4,6-dimethyl-isophthalonitrile
- Isophthalonitrile, 2-amino-4,6-dimethyl-
- 2-Amino-4,6-dimethyl-1,3-benzenedicarbonitrile
- 2,6-Dicyano-3,5-dimethylaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
