CAS 10273-91-3
:2-(2,6-Dimethylphenyl)pyridine
Description:
2-(2,6-Dimethylphenyl)pyridine, with the CAS number 10273-91-3, is an organic compound characterized by its pyridine ring substituted with a 2,6-dimethylphenyl group. This compound typically exhibits a pale yellow to brownish appearance and is known for its aromatic properties due to the presence of both the pyridine and phenyl rings. It has a relatively high melting point and boiling point, indicative of its stable structure. The presence of the dimethyl groups on the phenyl ring contributes to its hydrophobic nature, affecting its solubility in various solvents; it is generally more soluble in organic solvents than in water. Additionally, this compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems, making it potentially useful in various applications, including organic synthesis and as a ligand in coordination chemistry. Its reactivity can be influenced by the electron-donating effects of the methyl groups, which can affect its behavior in chemical reactions.
Formula:C13H13N
InChI:InChI=1S/C13H13N/c1-10-6-5-7-11(2)13(10)12-8-3-4-9-14-12/h3-9H,1-2H3
InChI key:InChIKey=NUQXCFWDHVYDED-UHFFFAOYSA-N
SMILES:CC1=C(C(C)=CC=C1)C2=CC=CC=N2
Synonyms:- 2-(2,6-Dimethylphenyl)pyridine
- Pyridine, 2-(2,6-xylyl)-
- Pyridine, 2-(2,6-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
