
CAS 1027335-65-4
:(βS)-β-Amino-4-hydroxy-3-iodobenzenepropanoic acid
Description:
(βS)-β-Amino-4-hydroxy-3-iodobenzenepropanoic acid, identified by its CAS number 1027335-65-4, is a chemical compound characterized by its amino acid structure, which includes a β-amino group and a hydroxyl group on the aromatic ring. This compound features a propanoic acid backbone, contributing to its classification as an amino acid derivative. The presence of the iodine atom at the 3-position of the benzene ring enhances its reactivity and potential applications in medicinal chemistry. The stereochemistry indicated by the (βS) designation suggests that it has specific spatial arrangements that may influence its biological activity and interactions with enzymes or receptors. This compound may exhibit properties typical of amino acids, such as solubility in water and the ability to participate in peptide bond formation. Its unique structural features could make it a candidate for research in drug development, particularly in areas targeting neurological or metabolic pathways. Further studies would be necessary to fully elucidate its biological properties and potential therapeutic applications.
Formula:C9H10INO3
InChI:InChI=1S/C9H10INO3/c10-6-3-5(1-2-8(6)12)7(11)4-9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m0/s1
InChI key:InChIKey=WGDQMDQCLHQPBM-ZETCQYMHSA-N
SMILES:[C@@H](CC(O)=O)(N)C1=CC(I)=C(O)C=C1
Synonyms:- (3S)-3-Amino-3-(4-hydroxy-3-iodophenyl)propanoic acid
- (βS)-β-Amino-4-hydroxy-3-iodobenzenepropanoic acid
- Benzenepropanoic acid, β-amino-4-hydroxy-3-iodo-, (βS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.