CAS 1027343-52-7

Bicyclo[3.1.1]heptane-3-carboxylic acid, 2-amino-6,6-dimethyl-, hydrochloride (1:1), (1R,2R,3R,5R)-

Description:

Bicyclo[3.1.1]heptane-3-carboxylic acid, 2-amino-6,6-dimethyl-, hydrochloride (1:1), (1R,2R,3R,5R)- is a bicyclic compound characterized by its unique structural framework, which includes a bicyclo[3.1.1]heptane core. This compound features a carboxylic acid functional group and an amino group, contributing to its potential as a bioactive molecule. The presence of the dimethyl substituents at the 6-position enhances steric hindrance, which can influence its reactivity and interactions with biological targets. The hydrochloride form indicates that the compound is protonated, enhancing its solubility in aqueous environments, which is often advantageous for pharmacological applications. The specific stereochemistry denoted by (1R,2R,3R,5R) suggests that the compound has defined spatial arrangements of its substituents, which can significantly affect its biological activity and interactions. Overall, this compound's unique structural and functional characteristics make it of interest in medicinal chemistry and related fields.

Formula: C₁₀H₁₇NO₂·ClH

InChI: InChI=1S/C10H17NO2.ClH/c1-10(2)5-3-6(9(12)13)8(11)7(10)4-5;/h5-8H,3-4,11H2,1-2H3,(H,12,13);1H/t5-,6+,7-,8-;/m0./s1

InChI key: InChIKey=YGVZSIXHDXOKQI-COMQYEOFSA-N

SMILES: CC1(C)[C@]2(C[C@@]1(C[C@@H](C(O)=O)[C@@H]2N)[H])[H].Cl

Synonyms:

• Bicyclo[3.1.1]heptane-3-carboxylic acid, 2-amino-6,6-dimethyl-, hydrochloride (1:1), (1R,2R,3R,5R)-

(1R,2R,3R,5R)-2-Amino-6,6-dimethylbicyclo[3.1.1]heptan-3-carboxylic acid hydrochloride

CAS: 1027343-52-7

(1R,2R,3R,5R)-2-Amino-6,6-dimethylbicyclo[3.1.1]heptan-3-carboxylic acid hydrochloride

Purity: ≥95%

Molecular weight: 219.71g/mol

Ref: 54-OR309442