CAS 1027346-22-0

6-Chloro-1-(2-propen-1-yl)-1H-indole

Description:

6-Chloro-1-(2-propen-1-yl)-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 6-position and a propenyl group at the 1-position contributes to its unique reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The chlorine substituent can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Additionally, the propenyl group may participate in further chemical transformations, such as polymerization or cross-coupling reactions. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, 6-Chloro-1-(2-propen-1-yl)-1H-indole represents a versatile building block in organic synthesis and pharmaceutical research.

Formula: C₁₁H₁₀ClN

InChI: InChI=1S/C11H10ClN/c1-2-6-13-7-5-9-3-4-10(12)8-11(9)13/h2-5,7-8H,1,6H2

InChI key: InChIKey=WIKNQHLKPUEFDU-UHFFFAOYSA-N

SMILES: C(C=C)N1C=2C(C=C1)=CC=C(Cl)C2

Synonyms:

• 1H-Indole, 6-chloro-1-(2-propen-1-yl)-
• 6-Chloro-1-(2-propen-1-yl)-1H-indole
• 1-Allyl-6-chloroindole