CymitQuimica logo

CAS 102737-76-8

:

2,7-Dihydroxy-3,6,10,11-tetrakis(pentyloxy)triphenylene

Description:
2,7-Dihydroxy-3,6,10,11-tetrakis(pentyloxy)triphenylene is a complex organic compound characterized by its polycyclic aromatic structure, which includes multiple hydroxyl groups and long alkoxy side chains. The presence of hydroxyl groups contributes to its potential solubility in polar solvents and may enhance its reactivity, particularly in forming hydrogen bonds. The tetrakis(pentyloxy) substituents provide significant hydrophobic character, influencing its physical properties such as melting point, boiling point, and solubility in organic solvents. This compound is likely to exhibit interesting optical properties due to its extended π-conjugated system, making it a candidate for applications in organic electronics, such as organic light-emitting diodes (OLEDs) or organic photovoltaics. Additionally, the structural features may impart unique thermal stability and mechanical properties, which are essential for various industrial applications. Overall, 2,7-Dihydroxy-3,6,10,11-tetrakis(pentyloxy)triphenylene represents a fascinating subject of study in materials science and organic chemistry.
Formula:C38H52O6
InChI:InChI=1/C38H52O6/c1-5-9-13-17-41-35-23-29-27(21-33(35)39)31-25-37(43-19-15-11-7-3)38(44-20-16-12-8-4)26-32(31)28-22-34(40)36(24-30(28)29)42-18-14-10-6-2/h21-26,39-40H,5-20H2,1-4H3
SMILES:CCCCCOc1cc2c(cc1O)c1cc(c(cc1c1cc(c(cc21)OCCCCC)O)OCCCCC)OCCCCC
Synonyms:
  • 3,6,10,11-Tetrakis(pentyloxy)triphenylene-2,7-diol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.