CAS 102739-99-1
:6-MeO-BDE 47
Description:
6-MeO-BDE 47, or 6-methoxy-bromodiphenyl ether, is a brominated flame retardant belonging to the class of polybrominated diphenyl ethers (PBDEs). It is characterized by the presence of a methoxy group (-OCH3) at the 6-position of the diphenyl ether structure, which influences its chemical properties and biological activity. This compound is known for its hydrophobic nature, which affects its environmental persistence and bioaccumulation potential. Like other PBDEs, 6-MeO-BDE 47 is used in various applications, particularly in textiles and plastics, to reduce flammability. However, it has raised environmental and health concerns due to its potential endocrine-disrupting effects and toxicity to aquatic organisms. The compound's stability and resistance to degradation contribute to its accumulation in the environment, leading to increased scrutiny and regulation in many regions. Overall, 6-MeO-BDE 47 exemplifies the challenges associated with the use of brominated flame retardants in consumer products.
Formula:C13H8Br4O2
InChI:InChI=1S/C13H8Br4O2/c1-18-12-6-8(15)5-10(17)13(12)19-11-3-2-7(14)4-9(11)16/h2-6H,1H3
InChI key:InChIKey=ASWWOOJPWUMGBW-UHFFFAOYSA-N
SMILES:O(C1=C(OC)C=C(Br)C=C1Br)C2=C(Br)C=C(Br)C=C2
Synonyms:- BC 3
- 1,5-Dibromo-2-(2,4-dibromophenoxy)-3-methoxybenzene
- 3,5-Dibromo-2-(2′,4′-dibromophenoxy)anisole
- Benzene, 1,5-dibromo-2-(2,4-dibromophenoxy)-3-methoxy-
- 6-Methoxy-2,2′,4,4′-tetrabromodiphenyl ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzene, 1,5-dibromo-2-(2,4-dibromophenoxy)-3-methoxy-
CAS:Formula:C13H8Br4O2Molecular weight:515.8174
