CAS 10275-07-7
:Benzoquinoneacetic acid
Description:
Benzoquinoneacetic acid, with the CAS number 10275-07-7, is an organic compound characterized by its unique structure that combines a benzoquinone moiety with an acetic acid functional group. This compound typically appears as a yellow to orange solid and is known for its reactivity due to the presence of the quinone structure, which can participate in various chemical reactions, including oxidation and reduction processes. Benzoquinoneacetic acid is soluble in organic solvents and exhibits moderate solubility in water, making it useful in various chemical applications. Its reactivity allows it to serve as an intermediate in organic synthesis and as a potential reagent in biochemical studies. Additionally, the compound may exhibit biological activity, which has led to interest in its potential applications in pharmaceuticals and agrochemicals. However, handling precautions should be observed due to its reactive nature and potential toxicity. Overall, benzoquinoneacetic acid is a significant compound in organic chemistry with diverse applications.
Formula:C8H6O4
InChI:InChI=1S/C8H6O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3H,4H2,(H,11,12)
InChI key:InChIKey=RAPRJRLALQKSHB-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C(=O)C=CC(=O)C1
Synonyms:- 1,4-Cyclohexadiene-1-acetic acid, 3,6-dioxo-
- 3,6-Dioxo-1,4-cyclohexadiene-1-acetic acid
- Benzoquinoneacetic acid
- 2-(3,6-Dioxocyclohexa-1,4-dien-1-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
