CAS 1027511-94-9

1-Acetylhexahydro-1H-azepine-4-carboxylic acid

Description:

1-Acetylhexahydro-1H-azepine-4-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a hexahydroazepine ring and a carboxylic acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in acid-base reactions. The presence of the acetyl group contributes to its reactivity, allowing for various chemical transformations. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. Additionally, the compound may exhibit specific stereochemical configurations, influencing its biological activity and interactions. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Overall, 1-Acetylhexahydro-1H-azepine-4-carboxylic acid represents a versatile structure with potential utility in various chemical and pharmaceutical applications.

Formula: C₉H₁₅NO₃

InChI: InChI=1S/C9H15NO3/c1-7(11)10-5-2-3-8(4-6-10)9(12)13/h8H,2-6H2,1H3,(H,12,13)

InChI key: InChIKey=GJGQKGPMFOLMPB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CCN(C(C)=O)CCC1

Synonyms:

• 1-Acetylhexahydro-1H-azepine-4-carboxylic acid
• 1H-Azepine-4-carboxylic acid, 1-acetylhexahydro-

1-Acetylazepane-4-carboxylic acid

CAS: 1027511-94-9

Formula: C₉H₁₅NO₃

Molecular weight: 185.2203

Ref: IN-DA0008AA