CAS 1027511-95-0
:1-(6-Bromo-2-pyridinyl)-2-pyrrolidinone
Description:
1-(6-Bromo-2-pyridinyl)-2-pyrrolidinone is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a pyrrolidinone moiety. This compound typically exhibits properties associated with both heterocyclic compounds and halogenated derivatives. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The pyrrolidinone part of the molecule contributes to its potential biological activity, as many pyrrolidinone derivatives are known for their pharmacological properties. Additionally, the compound may exhibit moderate solubility in organic solvents, which is common for similar heterocyclic compounds. Its specific applications can vary, but it may be explored in medicinal chemistry, particularly in the development of new therapeutic agents. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C9H9BrN2O
InChI:InChI=1S/C9H9BrN2O/c10-7-3-1-4-8(11-7)12-6-2-5-9(12)13/h1,3-4H,2,5-6H2
InChI key:InChIKey=LLAAHULUUFXMDX-UHFFFAOYSA-N
SMILES:O=C1N(C=2N=C(Br)C=CC2)CCC1
Synonyms:- 1-(6-Bromo-2-pyridinyl)-2-pyrrolidinone
- 2-Pyrrolidinone, 1-(6-bromo-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.