CAS 1027512-24-8
:2-Bromo-5-(1H-pyrrol-1-yl)pyrazine
Description:
2-Bromo-5-(1H-pyrrol-1-yl)pyrazine is a heterocyclic organic compound characterized by the presence of both bromine and a pyrrole moiety attached to a pyrazine ring. The compound features a pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions, contributing to its unique electronic properties. The bromine atom, located at the 2-position of the pyrazine, introduces a halogen functionality that can enhance reactivity and influence the compound's physical properties, such as solubility and boiling point. The pyrrole group, a five-membered ring containing one nitrogen atom, is attached at the 5-position of the pyrazine, adding to the compound's potential for forming hydrogen bonds and participating in various chemical reactions. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in drug development and as a building block in organic synthesis.
Formula:C8H6BrN3
InChI:InChI=1S/C8H6BrN3/c9-7-5-11-8(6-10-7)12-3-1-2-4-12/h1-6H
InChI key:InChIKey=WZRWWSBKNSBDKC-UHFFFAOYSA-N
SMILES:BrC=1N=CC(=NC1)N2C=CC=C2
Synonyms:- 2-Bromo-5-(1H-pyrrol-1-yl)pyrazine
- Pyrazine, 2-bromo-5-(1H-pyrrol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
