CAS 1027512-41-9
:6-Carboxytetramethylrhodamine N-succinimidyl ester
Description:
6-Carboxytetramethylrhodamine N-succinimidyl ester, often abbreviated as TMR or TMR-OSu, is a fluorescent dye commonly used in bioconjugation and labeling applications in biochemical research. This compound features a rhodamine core, which is known for its strong fluorescence properties, making it suitable for applications such as microscopy and flow cytometry. The presence of the carboxyl group allows for further conjugation with biomolecules, while the N-succinimidyl ester moiety facilitates the formation of stable amide bonds with primary amines in proteins or other biomolecules. This dye exhibits high photostability and brightness, which are critical for imaging applications. Additionally, it has a relatively high extinction coefficient and quantum yield, contributing to its effectiveness as a fluorescent marker. The compound is typically soluble in organic solvents and has specific excitation and emission wavelengths, making it useful for multiplexing in fluorescence-based assays. Overall, 6-Carboxytetramethylrhodamine N-succinimidyl ester is a versatile tool in molecular biology for visualizing and tracking biomolecules.
Formula:C29H25N3O7
InChI:InChI=1S/C29H25N3O7/c1-30(2)17-6-9-20-23(14-17)38-24-15-18(31(3)4)7-10-21(24)27(20)22-13-16(5-8-19(22)28(35)36)29(37)39-32-25(33)11-12-26(32)34/h5-10,13-15H,11-12H2,1-4H3
InChI key:InChIKey=PAOQTZWNYMMSEE-UHFFFAOYSA-N
SMILES:C([O-])(=O)C1=C(C=2C3=C([O+]=C4C2C=CC(N(C)C)=C4)C=C(N(C)C)C=C3)C=C(C(ON5C(=O)CCC5=O)=O)C=C1
Synonyms:- 6-TAMRA-SE
- Xanthylium, 9-[2-carboxy-5-[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]phenyl]-3,6-bis(dimethylamino)-, inner salt
- 6-TAMRA-NHS ester
- 2-[3-(Dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylbenzoate
- 6-Carboxytetramethylrhodamine N-succinimidyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.