CymitQuimica logo

CAS 1027512-51-1

:

6-Bromo-N,N-dimethyl-2-pyrazinamine

Description:
6-Bromo-N,N-dimethyl-2-pyrazinamine is an organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The compound features a bromine substituent at the 6-position of the pyrazine ring and two dimethylamino groups at the 2-position, contributing to its unique chemical properties. This structure imparts both basic and nucleophilic characteristics to the molecule, making it potentially useful in various chemical reactions and applications, such as in medicinal chemistry or as an intermediate in organic synthesis. The presence of the bromine atom enhances its reactivity, allowing for further functionalization. Additionally, the dimethylamino groups can influence the compound's solubility and interaction with biological systems. Overall, 6-Bromo-N,N-dimethyl-2-pyrazinamine is a compound of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals, due to its diverse chemical reactivity and potential biological activity.
Formula:C6H8BrN3
InChI:InChI=1S/C6H8BrN3/c1-10(2)6-4-8-3-5(7)9-6/h3-4H,1-2H3
InChI key:InChIKey=JWVZBBCKLDDCIQ-UHFFFAOYSA-N
SMILES:N(C)(C)C1=NC(Br)=CN=C1
Synonyms:
  • (6-Bromopyrazin-2-yl)dimethylamine
  • 2-Pyrazinamine, 6-bromo-N,N-dimethyl-
  • 6-Bromo-N,N-dimethyl-2-pyrazinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.