
CAS 1027513-03-6
:6-Bromo-N,N-diethyl-3-pyridazinamine
Description:
6-Bromo-N,N-diethyl-3-pyridazinamine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of the bromine atom at the 6-position contributes to its reactivity and potential applications in various chemical reactions. The N,N-diethyl substituents enhance its solubility and may influence its biological activity, making it of interest in medicinal chemistry. This compound may exhibit properties typical of pyridazine derivatives, such as potential antimicrobial or anti-inflammatory activities, although specific biological data would depend on empirical studies. Its molecular structure suggests it could participate in nucleophilic substitution reactions due to the presence of the bromine atom. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the substituents and the overall molecular geometry. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens and potential biological activity.
Formula:C8H12BrN3
InChI:InChI=1S/C8H12BrN3/c1-3-12(4-2)8-6-5-7(9)10-11-8/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=OYRCNECJYOINBC-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1=CC=C(Br)N=N1
Synonyms:- 3-Pyridazinamine, 6-bromo-N,N-diethyl-
- 6-Bromo-N,N-diethyl-3-pyridazinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.