
CAS 1027513-07-0
:3-Bromo-6-(1-pyrrolidinyl)pyridazine
Description:
3-Bromo-6-(1-pyrrolidinyl)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the 3-position introduces a halogen substituent, enhancing the compound's reactivity and potential applications in various chemical reactions. The 6-position features a pyrrolidine group, which is a five-membered nitrogen-containing heterocycle, contributing to the compound's biological activity and solubility properties. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. Additionally, the presence of both bromine and a nitrogen-containing heterocycle may enhance lipophilicity, affecting its bioavailability. As with many heterocyclic compounds, 3-Bromo-6-(1-pyrrolidinyl)pyridazine could serve as a valuable scaffold in drug discovery and development, warranting further investigation into its synthesis, reactivity, and biological effects.
Formula:C8H10BrN3
InChI:InChI=1S/C8H10BrN3/c9-7-3-4-8(11-10-7)12-5-1-2-6-12/h3-4H,1-2,5-6H2
InChI key:InChIKey=XNDDJWSDUGUMND-UHFFFAOYSA-N
SMILES:BrC1=CC=C(N=N1)N2CCCC2
Synonyms:- 3-Bromo-6-(1-pyrrolidinyl)pyridazine
- Pyridazine, 3-bromo-6-(1-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.