CAS 1027514-20-0

α,α,3-Trifluoro-4-methylbenzeneacetic acid

Description:

α,α,3-Trifluoro-4-methylbenzeneacetic acid is a chemical compound characterized by the presence of a trifluoromethyl group and a methyl group attached to a benzene ring, along with a carboxylic acid functional group. This compound is part of the aromatic carboxylic acids and exhibits properties typical of such compounds, including acidity due to the carboxylic acid group. The trifluoromethyl group contributes to its unique reactivity and solubility characteristics, often enhancing lipophilicity and influencing biological activity. The presence of fluorine atoms can also affect the compound's stability and interaction with other molecules. In terms of applications, compounds with similar structures are often explored in pharmaceuticals, agrochemicals, and materials science due to their potential biological activity and utility in synthesis. Safety data and handling precautions should be considered, as with any chemical substance, particularly those containing fluorine, which can pose specific health and environmental risks.

Formula: C₉H₇F₃O₂

InChI: InChI=1S/C9H7F3O2/c1-5-2-3-6(4-7(5)10)9(11,12)8(13)14/h2-4H,1H3,(H,13,14)

InChI key: InChIKey=LKVYRQAEUBCIDY-UHFFFAOYSA-N

SMILES: C(C(O)=O)(F)(F)C1=CC(F)=C(C)C=C1

Synonyms:

• α,α,3-Trifluoro-4-methylbenzeneacetic acid
• Benzeneacetic acid, α,α,3-trifluoro-4-methyl-
• Difluoro-(3-fluoro-4-methylphenyl)acetic acid
• 2,2-difluoro-2-(3-fluoro-4-methylphenyl)acetic acid

2,2-Difluoro-2-(3-fluoro-4-methylphenyl)acetic acid

CAS: 1027514-20-0

Formula: C₉H₇F₃O₂

Purity: 95.0%

Molecular weight: 204.148

Ref: 10-F035997