
CAS 10276-04-7
:[(3-Methyl-2-buten-1-yl)thio]benzene
Description:
[(3-Methyl-2-buten-1-yl)thio]benzene, also known by its CAS number 10276-04-7, is an organic compound characterized by the presence of a thioether functional group attached to a benzene ring. This compound features a side chain that includes a 3-methyl-2-buten-1-yl group, which contributes to its reactivity and potential applications in organic synthesis. The thioether linkage imparts unique chemical properties, such as increased nucleophilicity and the ability to participate in various chemical reactions, including substitution and addition reactions. The compound is typically a colorless to pale yellow liquid with a distinctive odor, indicative of its aromatic nature. Its solubility in organic solvents and limited solubility in water make it suitable for use in various chemical processes. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon exposure. Overall, [(3-Methyl-2-buten-1-yl)thio]benzene is of interest in both academic research and industrial applications due to its unique structural features.
Formula:C11H14S
InChI:InChI=1S/C11H14S/c1-10(2)8-9-12-11-6-4-3-5-7-11/h3-8H,9H2,1-2H3
InChI key:InChIKey=NYZWUNJQCIIVSA-UHFFFAOYSA-N
SMILES:S(CC=C(C)C)C1=CC=CC=C1
Synonyms:- Benzene, [(3-methyl-2-butenyl)thio]-
- Benzene, [(3-methyl-2-buten-1-yl)thio]-
- Prenyl phenyl sulfide
- Sulfide, 3-methyl-2-butenyl phenyl
- [(3-Methyl-2-buten-1-yl)thio]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
