CAS 102766-74-5

4-[4-(Trifluoromethyl)phenoxy]-2-methylaniline

Description:

4-[4-(Trifluoromethyl)phenoxy]-2-methylaniline, with the CAS number 102766-74-5, is an organic compound characterized by its complex structure, which includes a trifluoromethyl group, a phenoxy group, and an aniline moiety. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The trifluoromethyl group contributes to its lipophilicity and may enhance its biological activity, making it of interest in various chemical and pharmaceutical applications. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic reactions. Safety considerations are important, as compounds containing trifluoromethyl groups can exhibit unique toxicological profiles. Overall, this compound's unique structure and properties make it a subject of interest in synthetic chemistry and materials science.

Formula: C₁₄H₁₂F₃NO

InChI: InChI=1/C14H12F3NO/c1-9-8-12(6-7-13(9)18)19-11-4-2-10(3-5-11)14(15,16)17/h2-8H,18H2,1H3

SMILES: Cc1cc(ccc1N)Oc1ccc(cc1)C(F)(F)F

Synonyms:

• 2-Methyl-4-[4-(Trifluoromethyl)Phenoxy]Aniline

2-Methyl-4-(4-(trifluoromethyl)phenoxy)aniline

CAS: 102766-74-5

Formula: C₁₄H₁₂F₃NO

Molecular weight: 267.2464

Ref: IN-DA0008BT