CAS 102766-77-8
:4-(5-Nitro-2-pyridinyl)benzenamine
Description:
4-(5-Nitro-2-pyridinyl)benzenamine, with the CAS number 102766-77-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group and a nitro group attached to a pyridine ring. This compound typically exhibits properties associated with both aromatic amines and nitro compounds, such as potential reactivity due to the presence of the amino group, which can participate in nucleophilic reactions, and the nitro group, which can influence the compound's electronic properties and reactivity. The presence of the nitro group also suggests that the compound may have applications in the synthesis of other chemical entities or as a potential intermediate in pharmaceutical development. Additionally, the compound may exhibit specific solubility characteristics in various solvents, influenced by its polar functional groups. Safety and handling considerations are important, as nitro compounds can be hazardous, and appropriate precautions should be taken when working with this substance.
Formula:C11H9N3O2
InChI:InChI=1S/C11H9N3O2/c12-9-3-1-8(2-4-9)11-6-5-10(7-13-11)14(15)16/h1-7H,12H2
InChI key:InChIKey=DBHIATIGDZLUSE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(N=C1)C2=CC=C(N)C=C2
Synonyms:- Benzenamine, 4-(5-nitro-2-pyridinyl)-
- 2-(4-Aminophenyl)-5-nitropyridine
- 4-(5-Nitro-2-pyridinyl)benzenamine
- p-(5-Nitro-2-pyridyl)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
