CymitQuimica logo

CAS 102771-00-6

:

2-iodo-5-(trifluoromethyl)phenol

Description:
2-Iodo-5-(trifluoromethyl)phenol is an organic compound characterized by the presence of an iodine atom and a trifluoromethyl group attached to a phenolic structure. The molecular formula typically includes carbon, hydrogen, iodine, and fluorine atoms, reflecting its complex nature. This compound is known for its potential applications in pharmaceuticals and agrochemicals due to the reactivity imparted by the iodine and trifluoromethyl groups. The presence of the hydroxyl (-OH) group contributes to its solubility in polar solvents and can influence its acidity and reactivity in various chemical reactions. Additionally, the trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity. As with many halogenated compounds, 2-iodo-5-(trifluoromethyl)phenol may exhibit unique properties such as increased stability and altered electronic characteristics, making it of interest in synthetic organic chemistry and material science. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C7H4F3IO
InChI:InChI=1/C7H4F3IO/c8-7(9,10)4-1-2-5(11)6(12)3-4/h1-3,12H
InChI key:CWSAPAHVCIIVDH-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(F)(F)F)O)I
Found 2 products.