CAS 102774-86-7
:1-Pyrrolidinecarboxylic acid, 2,5-dioxo-, 9H-fluoren-9-ylmethyl ester
Description:
1-Pyrrolidinecarboxylic acid, 2,5-dioxo-, 9H-fluoren-9-ylmethyl ester, commonly referred to by its CAS number 102774-86-7, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a fluorenylmethyl ester moiety. This compound typically exhibits properties associated with both its pyrrolidine and fluorenyl groups, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid derivative. It may be utilized in various synthetic applications, particularly in the field of organic chemistry, where it can serve as an intermediate in the synthesis of more complex molecules. The presence of the dioxo functional groups suggests potential for hydrogen bonding and reactivity in condensation reactions. Additionally, the fluorenyl group may impart specific optical properties, making it of interest in materials science and medicinal chemistry. Overall, this compound's structural features contribute to its utility in diverse chemical applications.
Formula:C19H15NO4
InChI:InChI=1S/C19H15NO4/c21-17-9-10-18(22)20(17)19(23)24-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2
InChI key:InChIKey=BULODOHSYVQOJP-UHFFFAOYSA-N
SMILES:C(OC(=O)N1C(=O)CCC1=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- N-(9H-Fluoren-9-ylmethyloxycarbonyl)succinimide
- 2,5-Dioxopyrrolidin-1-yl 9H-fluoren-9-ylmethylcarbonate
- N-(9H-Fluoren-9-ylmethoxycarbonyl)succinimide
- 1-Pyrrolidinecarboxylic acid, 2,5-dioxo-, 9H-fluoren-9-ylmethyl ester
- (9H-Fluoren-9-yl)methyl 2,5-dioxopyrrolidine-1-carboxylate
- 9H-Fluoren-9-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Pyrrolidinecarboxylic acid, 2,5-dioxo-, 9H-fluoren-9-ylmethyl ester
CAS:Formula:C19H15NO4Molecular weight:321.3267
