CAS 102774-90-3
:(4S)-5-Amino-4-hydroxypentanoic acid
Description:
(4S)-5-Amino-4-hydroxypentanoic acid, also known as L-threonine, is an amino acid characterized by its hydroxyl and amino functional groups, which contribute to its polar nature. This compound is a chiral molecule, with the (4S) designation indicating its specific stereochemistry, which is crucial for its biological activity. It plays a significant role in protein synthesis and is a building block for various peptides and proteins. The presence of a hydroxyl group enhances its solubility in water, making it readily available for biological processes. Additionally, this amino acid is involved in various metabolic pathways, including those related to the synthesis of neurotransmitters and other essential biomolecules. Its CAS number, 102774-90-3, is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases. Overall, (4S)-5-Amino-4-hydroxypentanoic acid is essential in biochemistry and nutrition, contributing to various physiological functions in living organisms.
Formula:C5H11NO3
InChI:InChI=1S/C5H11NO3/c6-3-4(7)1-2-5(8)9/h4,7H,1-3,6H2,(H,8,9)/t4-/m0/s1
InChI key:InChIKey=TYMZJFJDBQLYHB-BYPYZUCNSA-N
SMILES:[C@H](CCC(O)=O)(CN)O
Synonyms:- (4S)-5-Amino-4-hydroxypentanoic acid
- (S)-(+)-5-Amino-4-hydroxypentanoic acid
- Pentanoic acid, 5-amino-4-hydroxy-, (S)-
- Pentanoic acid, 5-amino-4-hydroxy-, (4S)-
- (S)-5-Amino-4-hydroxypentanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
