
CAS 1027754-60-4
:5-(Methoxymethyl)-N-methyl-1H-pyrazole-3-methanamine
Description:
5-(Methoxymethyl)-N-methyl-1H-pyrazole-3-methanamine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a methoxymethyl group and a methylamine substituent, contributing to its unique reactivity and potential applications in medicinal chemistry. The presence of the methoxymethyl group enhances its solubility and may influence its biological activity. The compound's molecular structure suggests it could interact with various biological targets, making it of interest in drug development. Its CAS number, 1027754-60-4, allows for precise identification in chemical databases. As with many pyrazole derivatives, it may exhibit properties such as anti-inflammatory, analgesic, or antitumor activities, although specific biological effects would require empirical investigation. Safety and handling considerations are essential, as with all chemical substances, to ensure proper laboratory practices.
Formula:C7H13N3O
InChI:InChI=1S/C7H13N3O/c1-8-4-6-3-7(5-11-2)10-9-6/h3,8H,4-5H2,1-2H3,(H,9,10)
InChI key:InChIKey=LPVYZFDYHWFLKA-UHFFFAOYSA-N
SMILES:C(NC)C=1C=C(COC)NN1
Synonyms:- 1H-Pyrazole-3-methanamine, 5-(methoxymethyl)-N-methyl-
- 1-[5-(Methoxymethyl)-1H-pyrazol-3-yl]-N-methylmethanamine
- 5-(Methoxymethyl)-N-methyl-1H-pyrazole-3-methanamine
- [[3-(Methoxymethyl)-1H-pyrazol-5-yl]methyl](methyl)amine
- 1-[3-(Methoxymethyl)-1H-pyrazol-5-yl]-N-methylmethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.