CAS 102778-37-0

Cyclopentanamine, 2-methyl-, hydrochloride (1:1), (1S,2R)-

Description:

Cyclopentanamine, 2-methyl-, hydrochloride (1:1), (1S,2R)-, with the CAS number 102778-37-0, is a chemical compound characterized by its amine functional group and a cyclopentane ring structure. This compound is a chiral amine, meaning it has two enantiomers due to the presence of a stereocenter, which can influence its biological activity and interactions. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. Cyclopentanamine derivatives are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system. The specific stereochemistry (1S,2R) suggests that the compound has a defined spatial arrangement, which can significantly affect its reactivity and interaction with biological targets. Overall, this compound's unique structure and properties make it of interest in both synthetic chemistry and medicinal research.

Formula: C₆H₁₃N·ClH

InChI: InChI=1S/C6H13N.ClH/c1-5-3-2-4-6(5)7;/h5-6H,2-4,7H2,1H3;1H/t5-,6+;/m1./s1

InChI key: InChIKey=UEWUQJCETUWGDX-IBTYICNHSA-N

SMILES: C[C@H]1[C@@H](N)CCC1.Cl

Synonyms:

• Cyclopentanamine, 2-methyl-, hydrochloride, (1S,2R)-
• Cyclopentanamine, 2-methyl-, hydrochloride, (1S-cis)-
• Cyclopentanamine, 2-methyl-, hydrochloride (1:1), (1S,2R)-